C19H31N5OS — CID 111533993
1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111533993) has the molecular formula C19H31N5OS and a molecular weight of 377.56 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111533993 |
| Molecular Formula | C19H31N5OS |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCC(c1ccco1)N(CC)CC |
| InChI | InChI=1S/C19H31N5OS/c1-5-15-12-21-18(26-15)14-23-19(20-6-2)22-13-16(24(7-3)8-4)17-10-9-11-25-17/h9-12,16H,5-8,13-14H2,1-4H3,(H2,20,22,23) |
| InChIKey | BRARTIZYFDVNCK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|