C21H25F2N3O2 — CID 11153482
5-[6-(1-cyclopentylpiperidin-4-yl)oxy-3-pyridinyl]-1-(difluoromethyl)pyridin-2-one (PubChem CID 11153482) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 5-[6-(1-cyclopentylpiperidin-4-yl)oxy-3-pyridinyl]-1-(difluoromethyl)pyridin-2-one.
| Compound Name | 5-[6-(1-cyclopentylpiperidin-4-yl)oxy-3-pyridinyl]-1-(difluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 11153482 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 5-[6-(1-cyclopentylpiperidin-4-yl)oxy-3-pyridinyl]-1-(difluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(-c2ccc(OC3CCN(C4CCCC4)CC3)nc2)cn1C(F)F |
| InChI | InChI=1S/C21H25F2N3O2/c22-21(23)26-14-16(6-8-20(26)27)15-5-7-19(24-13-15)28-18-9-11-25(12-10-18)17-3-1-2-4-17/h5-8,13-14,17-18,21H,1-4,9-12H2 |
| InChIKey | YJZSACCTRAQBMZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |