C23H28ClFN2O2 — CID 59830596
3-chloro-4-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(1-fluoroethyl)pyridin-2-one (PubChem CID 59830596) has the molecular formula C23H28ClFN2O2 and a molecular weight of 418.94 g/mol. Its IUPAC name is 3-chloro-4-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(1-fluoroethyl)pyridin-2-one.
| Compound Name | 3-chloro-4-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(1-fluoroethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59830596 |
| Molecular Formula | C23H28ClFN2O2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 3-chloro-4-[4-(1-cyclopentylpiperidin-4-yl)oxyphenyl]-1-(1-fluoroethyl)pyridin-2-one |
| SMILES | CC(F)n1ccc(-c2ccc(OC3CCN(C4CCCC4)CC3)cc2)c(Cl)c1=O |
| InChI | InChI=1S/C23H28ClFN2O2/c1-16(25)27-15-12-21(22(24)23(27)28)17-6-8-19(9-7-17)29-20-10-13-26(14-11-20)18-4-2-3-5-18/h6-9,12,15-16,18,20H,2-5,10-11,13-14H2,1H3 |
| InChIKey | MVBLWSWOUGATHE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |