C17H23ClN2O2 — CID 142798153
2-chloro-2-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]acetamide (PubChem CID 142798153) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-2-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]acetamide.
| Compound Name | 2-chloro-2-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]acetamide |
|---|---|
| PubChem CID | 142798153 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-chloro-2-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]acetamide |
| SMILES | NC(=O)C(Cl)c1ccc(OC2CCN(C3CCC3)CC2)cc1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-16(17(19)21)12-4-6-14(7-5-12)22-15-8-10-20(11-9-15)13-2-1-3-13/h4-7,13,15-16H,1-3,8-11H2,(H2,19,21) |
| InChIKey | JWKWICZBJBSUBZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|