C22H24N2O — CID 143692391
4-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]benzonitrile (PubChem CID 143692391) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]benzonitrile.
| Compound Name | 4-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]benzonitrile |
|---|---|
| PubChem CID | 143692391 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-[4-(1-cyclobutylpiperidin-4-yl)oxyphenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OC3CCN(C4CCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O/c23-16-17-4-6-18(7-5-17)19-8-10-21(11-9-19)25-22-12-14-24(15-13-22)20-2-1-3-20/h4-11,20,22H,1-3,12-15H2 |
| InChIKey | JFHJNCPAGYFLEJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |