About 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile
4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 95907426) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile |
| PubChem CID | 95907426 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1ccc(OC2CCN(C(=O)C3[C@H]4CCCC[C@@H]34)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c21-13-14-5-7-15(8-6-14)24-16-9-11-22(12-10-16)20(23)19-17-3-1-2-4-18(17)19/h5-8,16-19H,1-4,9-12H2/t17-,18+,19? |
| InChIKey | PLZHFOMKFJMHPC-DFNIBXOVSA-N |
| XLogP | 3.36 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile?
The IUPAC name of 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile (CID 95907426) is 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile.
What is the SMILES notation for 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile?
The canonical SMILES for 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile is N#Cc1ccc(OC2CCN(C(=O)C3[C@H]4CCCC[C@@H]34)CC2)cc1.
What is the InChIKey of 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile?
The InChIKey is PLZHFOMKFJMHPC-DFNIBXOVSA-N. The full InChI is InChI=1S/C20H24N2O2/c21-13-14-5-7-15(8-6-14)24-16-9-11-22(12-10-16)20(23)19-17-3-1-2-4-18(17)19/h5-8,16-19H,1-4,9-12H2/t17-,18+,19?.
What are the key properties of 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile?
4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile has a molecular weight of 324.42 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(1S,6R)-bicyclo[4.1.0]heptane-7-carbonyl]piperidin-4-yl]oxybenzonitrile is sourced from PubChem (CID 95907426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).