C22H22N2O2 — CID 127281932
4-[1-(2,3-dihydro-1H-indene-4-carbonyl)piperidin-4-yl]oxybenzonitrile (PubChem CID 127281932) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[1-(2,3-dihydro-1H-indene-4-carbonyl)piperidin-4-yl]oxybenzonitrile.
| Compound Name | 4-[1-(2,3-dihydro-1H-indene-4-carbonyl)piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 127281932 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[1-(2,3-dihydro-1H-indene-4-carbonyl)piperidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1ccc(OC2CCN(C(=O)c3cccc4c3CCC4)CC2)cc1 |
| InChI | InChI=1S/C22H22N2O2/c23-15-16-7-9-18(10-8-16)26-19-11-13-24(14-12-19)22(25)21-6-2-4-17-3-1-5-20(17)21/h2,4,6-10,19H,1,3,5,11-14H2 |
| InChIKey | XLHLNMNIUPICJX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |