C17H22BrIN4S — CID 111535709
1-[2-(4-bromophenyl)cyclopropyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111535709) has the molecular formula C17H22BrIN4S and a molecular weight of 521.27 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)cyclopropyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111535709 |
| Molecular Formula | C17H22BrIN4S |
| Molecular Weight | 521.27 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | 1-[2-(4-bromophenyl)cyclopropyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NC2CC2c2ccc(Br)cc2)s1.I |
| InChI | InChI=1S/C17H21BrN4S.HI/c1-3-13-9-20-16(23-13)10-21-17(19-2)22-15-8-14(15)11-4-6-12(18)7-5-11;/h4-7,9,14-15H,3,8,10H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | WSHJFYWHOKPKMQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|