C18H25BrIN5 — CID 111952734
1-[2-(4-bromophenyl)cyclopropyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111952734) has the molecular formula C18H25BrIN5 and a molecular weight of 518.24 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)cyclopropyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-bromophenyl)cyclopropyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111952734 |
| Molecular Formula | C18H25BrIN5 |
| Molecular Weight | 518.24 g/mol |
| Exact Mass | 517.03 |
| IUPAC Name | 1-[2-(4-bromophenyl)cyclopropyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NC1CC1c1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H24BrN5.HI/c1-11-16(12(2)24(4)23-11)10-21-18(20-3)22-17-9-15(17)13-5-7-14(19)8-6-13;/h5-8,15,17H,9-10H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | HEAFAZMJWZRCJQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|