C14H17BrN2O3 — CID 111536284
4-bromo-N'-[2-(1-hydroxycyclopentyl)acetyl]benzohydrazide (PubChem CID 111536284) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 4-bromo-N'-[2-(1-hydroxycyclopentyl)acetyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[2-(1-hydroxycyclopentyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 111536284 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-bromo-N'-[2-(1-hydroxycyclopentyl)acetyl]benzohydrazide |
| SMILES | O=C(CC1(O)CCCC1)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrN2O3/c15-11-5-3-10(4-6-11)13(19)17-16-12(18)9-14(20)7-1-2-8-14/h3-6,20H,1-2,7-9H2,(H,16,18)(H,17,19) |
| InChIKey | ZUSFBJIFLNAIMJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|