C16H21FN2O3 — CID 111536336
2-(4-fluorophenyl)-N'-[2-(1-hydroxycyclohexyl)acetyl]acetohydrazide (PubChem CID 111536336) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N'-[2-(1-hydroxycyclohexyl)acetyl]acetohydrazide.
| Compound Name | 2-(4-fluorophenyl)-N'-[2-(1-hydroxycyclohexyl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 111536336 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N'-[2-(1-hydroxycyclohexyl)acetyl]acetohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)CC1(O)CCCCC1 |
| InChI | InChI=1S/C16H21FN2O3/c17-13-6-4-12(5-7-13)10-14(20)18-19-15(21)11-16(22)8-2-1-3-9-16/h4-7,22H,1-3,8-11H2,(H,18,20)(H,19,21) |
| InChIKey | BZCOHUSPUCJBPA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|