C17H18OSe2 — CID 11153665
(Z)-1,2-bis(phenylselanyl)pent-1-en-3-ol (PubChem CID 11153665) has the molecular formula C17H18OSe2 and a molecular weight of 396.25 g/mol. Its IUPAC name is (Z)-1,2-bis(phenylselanyl)pent-1-en-3-ol.
| Compound Name | (Z)-1,2-bis(phenylselanyl)pent-1-en-3-ol |
|---|---|
| PubChem CID | 11153665 |
| Molecular Formula | C17H18OSe2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | (Z)-1,2-bis(phenylselanyl)pent-1-en-3-ol |
| SMILES | CCC(O)/C(=C/[Se]c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C17H18OSe2/c1-2-16(18)17(20-15-11-7-4-8-12-15)13-19-14-9-5-3-6-10-14/h3-13,16,18H,2H2,1H3/b17-13- |
| InChIKey | FFVBBOVYQNRGFT-LGMDPLHJSA-N |
| XLogP | 1.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|