C18H26N2O6S — CID 11153748
N-[(E)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 11153748) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[(E)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11153748 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[(E)-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-12-6-8-13(9-7-12)27(21,22)20-19-10-14-16(26-18(4,5)24-14)15-11-23-17(2,3)25-15/h6-10,14-16,20H,11H2,1-5H3/b19-10+/t14-,15-,16+/m1/s1 |
| InChIKey | XSYPMPGPERYIKJ-WLBWQDNHSA-N |
| XLogP | 1.93 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|