C18H25NO2 — CID 111538084
N-[cyclobutyl(phenyl)methyl]-2-(1-hydroxycyclopentyl)acetamide (PubChem CID 111538084) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[cyclobutyl(phenyl)methyl]-2-(1-hydroxycyclopentyl)acetamide.
| Compound Name | N-[cyclobutyl(phenyl)methyl]-2-(1-hydroxycyclopentyl)acetamide |
|---|---|
| PubChem CID | 111538084 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[cyclobutyl(phenyl)methyl]-2-(1-hydroxycyclopentyl)acetamide |
| SMILES | O=C(CC1(O)CCCC1)NC(c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C18H25NO2/c20-16(13-18(21)11-4-5-12-18)19-17(15-9-6-10-15)14-7-2-1-3-8-14/h1-3,7-8,15,17,21H,4-6,9-13H2,(H,19,20) |
| InChIKey | OVBGJOXLEOJEDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |