C20H28N2O2 — CID 111538804
N,N-bis(cyclopropylmethyl)-4-(4-hydroxypiperidin-1-yl)benzamide (PubChem CID 111538804) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N,N-bis(cyclopropylmethyl)-4-(4-hydroxypiperidin-1-yl)benzamide.
| Compound Name | N,N-bis(cyclopropylmethyl)-4-(4-hydroxypiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 111538804 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N,N-bis(cyclopropylmethyl)-4-(4-hydroxypiperidin-1-yl)benzamide |
| SMILES | O=C(c1ccc(N2CCC(O)CC2)cc1)N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19-9-11-21(12-10-19)18-7-5-17(6-8-18)20(24)22(13-15-1-2-15)14-16-3-4-16/h5-8,15-16,19,23H,1-4,9-14H2 |
| InChIKey | YRSBTTWWBLVEHO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |