C19H28N2O2S — CID 71866658
4-(4-hydroxypiperidin-1-yl)-N-methyl-N-(3-methylsulfanylcyclopentyl)benzamide (PubChem CID 71866658) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is 4-(4-hydroxypiperidin-1-yl)-N-methyl-N-(3-methylsulfanylcyclopentyl)benzamide.
| Compound Name | 4-(4-hydroxypiperidin-1-yl)-N-methyl-N-(3-methylsulfanylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 71866658 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 4-(4-hydroxypiperidin-1-yl)-N-methyl-N-(3-methylsulfanylcyclopentyl)benzamide |
| SMILES | CSC1CCC(N(C)C(=O)c2ccc(N3CCC(O)CC3)cc2)C1 |
| InChI | InChI=1S/C19H28N2O2S/c1-20(16-7-8-18(13-16)24-2)19(23)14-3-5-15(6-4-14)21-11-9-17(22)10-12-21/h3-6,16-18,22H,7-13H2,1-2H3 |
| InChIKey | HKHJFTGRGSQENX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |