C18H30N2O3 — CID 111538893
1-[[1-[2-(1-hydroxycyclopentyl)acetyl]piperidin-4-yl]methyl]piperidin-2-one (PubChem CID 111538893) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[[1-[2-(1-hydroxycyclopentyl)acetyl]piperidin-4-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[1-[2-(1-hydroxycyclopentyl)acetyl]piperidin-4-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 111538893 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-[[1-[2-(1-hydroxycyclopentyl)acetyl]piperidin-4-yl]methyl]piperidin-2-one |
| SMILES | O=C(CC1(O)CCCC1)N1CCC(CN2CCCCC2=O)CC1 |
| InChI | InChI=1S/C18H30N2O3/c21-16-5-1-4-10-20(16)14-15-6-11-19(12-7-15)17(22)13-18(23)8-2-3-9-18/h15,23H,1-14H2 |
| InChIKey | PEFPLUOMYRVPHS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |