C21H28N2O4 — CID 119185876
4-[3-oxo-3-[4-[(2-oxopiperidin-1-yl)methyl]piperidin-1-yl]propyl]benzoic acid (PubChem CID 119185876) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[3-oxo-3-[4-[(2-oxopiperidin-1-yl)methyl]piperidin-1-yl]propyl]benzoic acid.
| Compound Name | 4-[3-oxo-3-[4-[(2-oxopiperidin-1-yl)methyl]piperidin-1-yl]propyl]benzoic acid |
|---|---|
| PubChem CID | 119185876 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[3-oxo-3-[4-[(2-oxopiperidin-1-yl)methyl]piperidin-1-yl]propyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(=O)N2CCC(CN3CCCCC3=O)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c24-19-3-1-2-12-23(19)15-17-10-13-22(14-11-17)20(25)9-6-16-4-7-18(8-5-16)21(26)27/h4-5,7-8,17H,1-3,6,9-15H2,(H,26,27) |
| InChIKey | NOLXLVFAOPGCCN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |