C20H27N3O4 — CID 119136022
2-[4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]phenoxy]acetamide (PubChem CID 119136022) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]phenoxy]acetamide.
| Compound Name | 2-[4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 119136022 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-[4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C(=O)N2CCC(CN3CCCCC3=O)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O4/c21-18(24)14-27-17-6-4-16(5-7-17)20(26)22-11-8-15(9-12-22)13-23-10-2-1-3-19(23)25/h4-7,15H,1-3,8-14H2,(H2,21,24) |
| InChIKey | HXPHKVNXSKLRIW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |