C23H28N2O4 — CID 17409629
2-[4-[4-[2-(4-methoxyphenyl)ethyl]piperidine-1-carbonyl]phenoxy]acetamide (PubChem CID 17409629) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[4-[4-[2-(4-methoxyphenyl)ethyl]piperidine-1-carbonyl]phenoxy]acetamide.
| Compound Name | 2-[4-[4-[2-(4-methoxyphenyl)ethyl]piperidine-1-carbonyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17409629 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 2-[4-[4-[2-(4-methoxyphenyl)ethyl]piperidine-1-carbonyl]phenoxy]acetamide |
| SMILES | COc1ccc(CCC2CCN(C(=O)c3ccc(OCC(N)=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-28-20-8-4-17(5-9-20)2-3-18-12-14-25(15-13-18)23(27)19-6-10-21(11-7-19)29-16-22(24)26/h4-11,18H,2-3,12-16H2,1H3,(H2,24,26) |
| InChIKey | IKLRGALFUOUATE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |