C18H23N3O4 — CID 119185875
4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119185875) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119185875 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-[4-[(2-oxopiperidin-1-yl)methyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)N2CCC(CN3CCCCC3=O)CC2)ccn1 |
| InChI | InChI=1S/C18H23N3O4/c22-16-3-1-2-8-21(16)12-13-5-9-20(10-6-13)17(23)14-4-7-19-15(11-14)18(24)25/h4,7,11,13H,1-3,5-6,8-10,12H2,(H,24,25) |
| InChIKey | GVDWRCOMZWJIGE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |