C15H19N3O4 — CID 119186144
4-[4-[2-(methylamino)-2-oxoethyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119186144) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[4-[2-(methylamino)-2-oxoethyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[4-[2-(methylamino)-2-oxoethyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119186144 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[4-[2-(methylamino)-2-oxoethyl]piperidine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | CNC(=O)CC1CCN(C(=O)c2ccnc(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C15H19N3O4/c1-16-13(19)8-10-3-6-18(7-4-10)14(20)11-2-5-17-12(9-11)15(21)22/h2,5,9-10H,3-4,6-8H2,1H3,(H,16,19)(H,21,22) |
| InChIKey | INKUBSDBWDFLRC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |