C25H31N3O3 — CID 111541202
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine (PubChem CID 111541202) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111541202 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(furan-2-yl)ethyl]-3-(1-phenylethyl)guanidine |
| SMILES | COc1ccc(CCN/C(=N/CCc2ccco2)NC(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H31N3O3/c1-19(21-8-5-4-6-9-21)28-25(27-16-14-22-10-7-17-31-22)26-15-13-20-11-12-23(29-2)24(18-20)30-3/h4-12,17-19H,13-16H2,1-3H3,(H2,26,27,28) |
| InChIKey | JZXDWEQODKALHN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|