About dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate
dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate (PubChem CID 11155093) has the molecular formula C24H18ClN3O4
and a molecular weight of 447.88 g/mol. Its IUPAC name is dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate |
| PubChem CID | 11155093 |
| Molecular Formula | C24H18ClN3O4 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2c[nH]c3ccc(Cl)cc23)c1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H18ClN3O4/c1-31-23(29)21-19(15-10-26-17-6-4-3-5-13(15)17)20(22(28-21)24(30)32-2)16-11-27-18-8-7-12(25)9-14(16)18/h3-11,26-28H,1-2H3 |
| InChIKey | KJGOESWUEDEYLP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The IUPAC name of dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate (CID 11155093) is dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate.
What is the SMILES notation for dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The canonical SMILES for dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate is COC(=O)c1[nH]c(C(=O)OC)c(-c2c[nH]c3ccc(Cl)cc23)c1-c1c[nH]c2ccccc12.
What is the InChIKey of dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
The InChIKey is KJGOESWUEDEYLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18ClN3O4/c1-31-23(29)21-19(15-10-26-17-6-4-3-5-13(15)17)20(22(28-21)24(30)32-2)16-11-27-18-8-7-12(25)9-14(16)18/h3-11,26-28H,1-2H3.
What are the key properties of dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate?
dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate has a molecular weight of 447.88 g/mol, XLogP of 5.54, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(5-chloro-1H-indol-3-yl)-4-(1H-indol-3-yl)-1H-pyrrole-2,5-dicarboxylate is sourced from PubChem (CID 11155093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).