C22H27N5OS — CID 111551774
2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine (PubChem CID 111551774) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111551774 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-methyl-1-[(2-phenyl-1,3-oxazol-4-yl)methyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nc2c(s1)CCCC2)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H27N5OS/c1-23-22(24-13-7-12-20-27-18-10-5-6-11-19(18)29-20)25-14-17-15-28-21(26-17)16-8-3-2-4-9-16/h2-4,8-9,15H,5-7,10-14H2,1H3,(H2,23,24,25) |
| InChIKey | AWNNXBRCPHBYBL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|