C19H25FN4S — CID 111875895
1-[(3-fluorophenyl)methyl]-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine (PubChem CID 111875895) has the molecular formula C19H25FN4S and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111875895 |
| Molecular Formula | C19H25FN4S |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nc2c(s1)CCCC2)NCc1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN4S/c1-21-19(23-13-14-6-4-7-15(20)12-14)22-11-5-10-18-24-16-8-2-3-9-17(16)25-18/h4,6-7,12H,2-3,5,8-11,13H2,1H3,(H2,21,22,23) |
| InChIKey | BFDPFQDJSACXRC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|