C19H24FN3O — CID 111835671
1-[3-(3-fluorophenyl)propyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111835671) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[3-(3-fluorophenyl)propyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[3-(3-fluorophenyl)propyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111835671 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[3-(3-fluorophenyl)propyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCc1cccc(F)c1)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H24FN3O/c1-21-19(23-14-16-8-10-18(24-2)11-9-16)22-12-4-6-15-5-3-7-17(20)13-15/h3,5,7-11,13H,4,6,12,14H2,1-2H3,(H2,21,22,23) |
| InChIKey | WYHQQVNNJSMUQR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|