C21H30N4O2S2 — CID 111613217
2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine (PubChem CID 111613217) has the molecular formula C21H30N4O2S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111613217 |
| Molecular Formula | C21H30N4O2S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-methyl-1-[2-(4-methylsulfonylphenyl)ethyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCc1nc2c(s1)CCCC2)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H30N4O2S2/c1-22-21(24-15-13-16-9-11-17(12-10-16)29(2,26)27)23-14-5-8-20-25-18-6-3-4-7-19(18)28-20/h9-12H,3-8,13-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | XEAHTPUOMGOHIH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|