C24H28IN5O3 — CID 111552179
N-[3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111552179) has the molecular formula C24H28IN5O3 and a molecular weight of 561.42 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111552179 |
| Molecular Formula | C24H28IN5O3 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCO2)c1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C24H27N5O3.HI/c1-25-24(27-15-20-16-32-23(29-20)18-8-3-2-4-9-18)26-14-17-7-5-10-19(13-17)28-22(30)21-11-6-12-31-21;/h2-5,7-10,13,16,21H,6,11-12,14-15H2,1H3,(H,28,30)(H2,25,26,27);1H |
| InChIKey | WCMWPGHJUZWOMG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|