C25H30IN5O3 — CID 111590682
N-[3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111590682) has the molecular formula C25H30IN5O3 and a molecular weight of 575.45 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111590682 |
| Molecular Formula | C25H30IN5O3 |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]carbamimidoyl]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(NC(=O)C2CCCO2)c1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C25H29N5O3.HI/c1-17-8-10-19(11-9-17)24-30-21(16-33-24)15-28-25(26-2)27-14-18-5-3-6-20(13-18)29-23(31)22-7-4-12-32-22;/h3,5-6,8-11,13,16,22H,4,7,12,14-15H2,1-2H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | MIRNISWFFVSJDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|