C28H46N4O — CID 11155268
3-(6-aminohexyl)-1-phenyl-8-(4-propan-2-ylcyclohexyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 11155268) has the molecular formula C28H46N4O and a molecular weight of 454.70 g/mol. Its IUPAC name is 3-(6-aminohexyl)-1-phenyl-8-(4-propan-2-ylcyclohexyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-(6-aminohexyl)-1-phenyl-8-(4-propan-2-ylcyclohexyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 11155268 |
| Molecular Formula | C28H46N4O |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | 3-(6-aminohexyl)-1-phenyl-8-(4-propan-2-ylcyclohexyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC(C)C1CCC(N2CCC3(CC2)C(=O)N(CCCCCCN)CN3c2ccccc2)CC1 |
| InChI | InChI=1S/C28H46N4O/c1-23(2)24-12-14-25(15-13-24)30-20-16-28(17-21-30)27(33)31(19-9-4-3-8-18-29)22-32(28)26-10-6-5-7-11-26/h5-7,10-11,23-25H,3-4,8-9,12-22,29H2,1-2H3 |
| InChIKey | MKPZLYLCLWTUKS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|