C20H24IN5O2S — CID 111553666
N-[3-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111553666) has the molecular formula C20H24IN5O2S and a molecular weight of 525.42 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111553666 |
| Molecular Formula | C20H24IN5O2S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[3-[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1cccs1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C20H23N5O2S.HI/c1-21-20(23-11-6-10-22-18(26)17-9-5-12-28-17)24-13-16-14-27-19(25-16)15-7-3-2-4-8-15;/h2-5,7-9,12,14H,6,10-11,13H2,1H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | GJBNDXVITLUPLQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|