C23H27IN6O — CID 111553878
2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111553878) has the molecular formula C23H27IN6O and a molecular weight of 530.41 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553878 |
| Molecular Formula | C23H27IN6O |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-methyl-1-[3-(2-methylbenzimidazol-1-yl)propyl]-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C23H26N6O.HI/c1-17-27-20-11-6-7-12-21(20)29(17)14-8-13-25-23(24-2)26-15-19-16-30-22(28-19)18-9-4-3-5-10-18;/h3-7,9-12,16H,8,13-15H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | XFULQDBFJUIOLU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|