C19H23N7S — CID 111352044
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine (PubChem CID 111352044) has the molecular formula C19H23N7S and a molecular weight of 381.51 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111352044 |
| Molecular Formula | C19H23N7S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methyl-3-[3-(2-methylbenzimidazol-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCn1c(C)nc2ccccc21)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C19H23N7S/c1-14-23-16-6-3-4-7-17(16)26(14)9-5-8-21-18(20-2)22-12-15-13-25-10-11-27-19(25)24-15/h3-4,6-7,10-11,13H,5,8-9,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | TUDDJYBVTXZBPD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|