C25H22ClN5O2 — CID 11155398
4-chloro-N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]benzamide (PubChem CID 11155398) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is 4-chloro-N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 11155398 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-chloro-N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]benzamide |
| SMILES | Nc1nc(N)c(-c2ccc(NC(=O)c3ccc(Cl)cc3)cc2)c(COCc2ccccc2)n1 |
| InChI | InChI=1S/C25H22ClN5O2/c26-19-10-6-18(7-11-19)24(32)29-20-12-8-17(9-13-20)22-21(30-25(28)31-23(22)27)15-33-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,29,32)(H4,27,28,30,31) |
| InChIKey | HMVBVORAUABLNG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |