C22H28IN3O3 — CID 111555172
methyl 4-[2-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]benzoate;hydroiodide (PubChem CID 111555172) has the molecular formula C22H28IN3O3 and a molecular weight of 509.39 g/mol. Its IUPAC name is methyl 4-[2-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111555172 |
| Molecular Formula | C22H28IN3O3 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | methyl 4-[2-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]benzoate;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCCc1ccc(C(=O)OC)cc1.I |
| InChI | InChI=1S/C22H27N3O3.HI/c1-4-15-28-20-8-6-5-7-19(20)16-25-22(23-2)24-14-13-17-9-11-18(12-10-17)21(26)27-3;/h4-12H,1,13-16H2,2-3H3,(H2,23,24,25);1H |
| InChIKey | MPTRDPRDDRPEFY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|