C23H30FIN4O2 — CID 111556581
N-[2-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111556581) has the molecular formula C23H30FIN4O2 and a molecular weight of 540.42 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111556581 |
| Molecular Formula | C23H30FIN4O2 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCCNC(=O)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C23H29FN4O2.HI/c1-3-14-30-21-11-6-5-9-19(21)17-28-23(25-4-2)27-13-12-26-22(29)16-18-8-7-10-20(24)15-18;/h3,5-11,15H,1,4,12-14,16-17H2,2H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | MERCHQHAEUCXTL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|