C22H29IN4OS — CID 111557101
3-[[[ethylamino-[(1-phenylsulfanylcyclopropyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide (PubChem CID 111557101) has the molecular formula C22H29IN4OS and a molecular weight of 524.47 g/mol. Its IUPAC name is 3-[[[ethylamino-[(1-phenylsulfanylcyclopropyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[(1-phenylsulfanylcyclopropyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111557101 |
| Molecular Formula | C22H29IN4OS |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 3-[[[ethylamino-[(1-phenylsulfanylcyclopropyl)methylamino]methylidene]amino]methyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H28N4OS.HI/c1-3-24-21(25-15-17-8-7-9-18(14-17)20(27)23-2)26-16-22(12-13-22)28-19-10-5-4-6-11-19;/h4-11,14H,3,12-13,15-16H2,1-2H3,(H,23,27)(H2,24,25,26);1H |
| InChIKey | WSQWBYPCAOPNFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|