C17H26IN3O2S — CID 111557231
methyl 3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111557231) has the molecular formula C17H26IN3O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is methyl 3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111557231 |
| Molecular Formula | C17H26IN3O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | methyl 3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CC1(Sc2ccccc2)CC1)NCCC(=O)OC.I |
| InChI | InChI=1S/C17H25N3O2S.HI/c1-3-18-16(19-12-9-15(21)22-2)20-13-17(10-11-17)23-14-7-5-4-6-8-14;/h4-8H,3,9-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | WYBOZWOMUXYTJC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|