C21H28N4O2S2 — CID 111557721
2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine (PubChem CID 111557721) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 111557721 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-methyl-1-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1cccc(CS(=O)(=O)NC)c1)NCC1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N4O2S2/c1-22-20(25-16-21(11-12-21)28-19-9-4-3-5-10-19)24-14-17-7-6-8-18(13-17)15-29(26,27)23-2/h3-10,13,23H,11-12,14-16H2,1-2H3,(H2,22,24,25) |
| InChIKey | NAAPKTJLSDZIRL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|