C24H32N4O2 — CID 111559062
2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine (PubChem CID 111559062) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111559062 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-ethyl-3-[2-(2-methoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCC(=O)N1Cc2ccccc2C1)NCCc1ccccc1OC |
| InChI | InChI=1S/C24H32N4O2/c1-3-25-24(27-16-14-19-9-6-7-12-22(19)30-2)26-15-8-13-23(29)28-17-20-10-4-5-11-21(20)18-28/h4-7,9-12H,3,8,13-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | VTTAMJWDIJWUQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|