C25H35IN4O3 — CID 111559073
2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111559073) has the molecular formula C25H35IN4O3 and a molecular weight of 566.48 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111559073 |
| Molecular Formula | C25H35IN4O3 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)N1Cc2ccccc2C1)NCCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C25H34N4O3.HI/c1-4-26-25(28-15-13-19-11-12-22(31-2)23(16-19)32-3)27-14-7-10-24(30)29-17-20-8-5-6-9-21(20)18-29;/h5-6,8-9,11-12,16H,4,7,10,13-15,17-18H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | PZPURSCTDHVWQJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|