C21H29IN4OS — CID 111560293
2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111560293) has the molecular formula C21H29IN4OS and a molecular weight of 512.46 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111560293 |
| Molecular Formula | C21H29IN4OS |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(1-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)N1CCc2ccccc21)NC(C)c1cccs1.I |
| InChI | InChI=1S/C21H28N4OS.HI/c1-3-22-21(24-16(2)19-10-7-15-27-19)23-13-6-11-20(26)25-14-12-17-8-4-5-9-18(17)25;/h4-5,7-10,15-16H,3,6,11-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | IFDJZQYHDXMKHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|