C21H33IN4O2 — CID 111979318
2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide (PubChem CID 111979318) has the molecular formula C21H33IN4O2 and a molecular weight of 500.43 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979318 |
| Molecular Formula | C21H33IN4O2 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)N1CCc2ccccc21)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C21H32N4O2.HI/c1-2-22-21(24-17-9-11-18(26)12-10-17)23-14-5-8-20(27)25-15-13-16-6-3-4-7-19(16)25;/h3-4,6-7,17-18,26H,2,5,8-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | MYCCOWFLQDDIFD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|