C12H13F3N2O3 — CID 111561298
1-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)pyridin-2-one (PubChem CID 111561298) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 1-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 111561298 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)9-2-1-4-17(11(9)20)7-10(19)16-5-3-8(18)6-16/h1-2,4,8,18H,3,5-7H2/t8-/m1/s1 |
| InChIKey | HLVSMJPPHVQDRU-MRVPVSSYSA-N |
| XLogP | 0.46 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |