C13H13F3N2O4 — CID 124700161
(3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 124700161) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is (3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124700161 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (3R)-1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCN(C(=O)Cn2cccc(C(F)(F)F)c2=O)C1 |
| InChI | InChI=1S/C13H13F3N2O4/c14-13(15,16)9-2-1-4-18(11(9)20)7-10(19)17-5-3-8(6-17)12(21)22/h1-2,4,8H,3,5-7H2,(H,21,22)/t8-/m1/s1 |
| InChIKey | HBRREUCVZRJLAH-MRVPVSSYSA-N |
| XLogP | 0.80 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |