C18H32N2O3 — CID 111564462
1-[[2-(1-hydroxycyclohexyl)acetyl]amino]-N-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 111564462) has the molecular formula C18H32N2O3 and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-[[2-(1-hydroxycyclohexyl)acetyl]amino]-N-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | 1-[[2-(1-hydroxycyclohexyl)acetyl]amino]-N-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111564462 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 1-[[2-(1-hydroxycyclohexyl)acetyl]amino]-N-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)CNC(=O)C1(NC(=O)CC2(O)CCCCC2)CCCC1 |
| InChI | InChI=1S/C18H32N2O3/c1-14(2)13-19-16(22)18(10-6-7-11-18)20-15(21)12-17(23)8-4-3-5-9-17/h14,23H,3-13H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | DHILOGRQZFRTSZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |