C21H25F2IN4O — CID 111566666
1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111566666) has the molecular formula C21H25F2IN4O and a molecular weight of 514.36 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111566666 |
| Molecular Formula | C21H25F2IN4O |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(F)c1F)NCc1ccc(N2CCCC2=O)cc1.I |
| InChI | InChI=1S/C21H24F2N4O.HI/c1-24-21(25-12-11-16-4-2-5-18(22)20(16)23)26-14-15-7-9-17(10-8-15)27-13-3-6-19(27)28;/h2,4-5,7-10H,3,6,11-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | JVRDIJHMIOAKJR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|