C24H30IN5O — CID 111787518
2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111787518) has the molecular formula C24H30IN5O and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111787518 |
| Molecular Formula | C24H30IN5O |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-methyl-1-[2-(7-methyl-1H-indol-3-yl)ethyl]-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2c(C)cccc12)NCc1ccc(N2CCCC2=O)cc1.I |
| InChI | InChI=1S/C24H29N5O.HI/c1-17-5-3-6-21-19(16-27-23(17)21)12-13-26-24(25-2)28-15-18-8-10-20(11-9-18)29-14-4-7-22(29)30;/h3,5-6,8-11,16,27H,4,7,12-15H2,1-2H3,(H2,25,26,28);1H |
| InChIKey | UFGNVFMOEGIPSX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|