C13H12F4N2O3 — CID 111567096
N-[4-fluoro-2-(trifluoromethyl)phenyl]-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 111567096) has the molecular formula C13H12F4N2O3 and a molecular weight of 320.24 g/mol. Its IUPAC name is N-[4-fluoro-2-(trifluoromethyl)phenyl]-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[4-fluoro-2-(trifluoromethyl)phenyl]-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 111567096 |
| Molecular Formula | C13H12F4N2O3 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[4-fluoro-2-(trifluoromethyl)phenyl]-2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(F)cc1C(F)(F)F)C(=O)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C13H12F4N2O3/c14-7-1-2-10(9(5-7)13(15,16)17)18-11(21)12(22)19-4-3-8(20)6-19/h1-2,5,8,20H,3-4,6H2,(H,18,21)/t8-/m1/s1 |
| InChIKey | LNWZZIMPAAFAOK-MRVPVSSYSA-N |
| XLogP | 1.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|